C12H16F3NS — CID 103793144
4-methylsulfanyl-N-[(2,4,5-trifluorophenyl)methyl]butan-2-amine (PubChem CID 103793144) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[(2,4,5-trifluorophenyl)methyl]butan-2-amine.
| Compound Name | 4-methylsulfanyl-N-[(2,4,5-trifluorophenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 103793144 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-methylsulfanyl-N-[(2,4,5-trifluorophenyl)methyl]butan-2-amine |
| SMILES | CSCCC(C)NCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H16F3NS/c1-8(3-4-17-2)16-7-9-5-11(14)12(15)6-10(9)13/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | QIECSWZWALZLMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|