C11H12F3NO — CID 115763151
[1-[(2,4,5-trifluorophenyl)methylamino]cyclopropyl]methanol (PubChem CID 115763151) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is [1-[(2,4,5-trifluorophenyl)methylamino]cyclopropyl]methanol.
| Compound Name | [1-[(2,4,5-trifluorophenyl)methylamino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 115763151 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [1-[(2,4,5-trifluorophenyl)methylamino]cyclopropyl]methanol |
| SMILES | OCC1(NCc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C11H12F3NO/c12-8-4-10(14)9(13)3-7(8)5-15-11(6-16)1-2-11/h3-4,15-16H,1-2,5-6H2 |
| InChIKey | DSXXXAUVKDECOV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|