C12H15BrFNO — CID 115733345
[1-[(4-bromo-2-fluorophenyl)methylamino]cyclobutyl]methanol (PubChem CID 115733345) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is [1-[(4-bromo-2-fluorophenyl)methylamino]cyclobutyl]methanol.
| Compound Name | [1-[(4-bromo-2-fluorophenyl)methylamino]cyclobutyl]methanol |
|---|---|
| PubChem CID | 115733345 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [1-[(4-bromo-2-fluorophenyl)methylamino]cyclobutyl]methanol |
| SMILES | OCC1(NCc2ccc(Br)cc2F)CCC1 |
| InChI | InChI=1S/C12H15BrFNO/c13-10-3-2-9(11(14)6-10)7-15-12(8-16)4-1-5-12/h2-3,6,15-16H,1,4-5,7-8H2 |
| InChIKey | SCSMGPXTBWIAIO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |