C17H26BrNO2 — CID 62520098
[1-[(5-bromo-2-propoxyphenyl)methylamino]cyclohexyl]methanol (PubChem CID 62520098) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is [1-[(5-bromo-2-propoxyphenyl)methylamino]cyclohexyl]methanol.
| Compound Name | [1-[(5-bromo-2-propoxyphenyl)methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 62520098 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [1-[(5-bromo-2-propoxyphenyl)methylamino]cyclohexyl]methanol |
| SMILES | CCCOc1ccc(Br)cc1CNC1(CO)CCCCC1 |
| InChI | InChI=1S/C17H26BrNO2/c1-2-10-21-16-7-6-15(18)11-14(16)12-19-17(13-20)8-4-3-5-9-17/h6-7,11,19-20H,2-5,8-10,12-13H2,1H3 |
| InChIKey | RYQXRWAYJYFXDQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |