C16H26BrNO2 — CID 62518917
2-[(5-bromo-2-propoxyphenyl)methylamino]-2-ethylbutan-1-ol (PubChem CID 62518917) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-[(5-bromo-2-propoxyphenyl)methylamino]-2-ethylbutan-1-ol.
| Compound Name | 2-[(5-bromo-2-propoxyphenyl)methylamino]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 62518917 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(5-bromo-2-propoxyphenyl)methylamino]-2-ethylbutan-1-ol |
| SMILES | CCCOc1ccc(Br)cc1CNC(CC)(CC)CO |
| InChI | InChI=1S/C16H26BrNO2/c1-4-9-20-15-8-7-14(17)10-13(15)11-18-16(5-2,6-3)12-19/h7-8,10,18-19H,4-6,9,11-12H2,1-3H3 |
| InChIKey | KXXGXBVPTWFAKE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |