C13H20BrNO3 — CID 65312603
2-[(5-bromo-2-propoxyphenyl)methylamino]propane-1,3-diol (PubChem CID 65312603) has the molecular formula C13H20BrNO3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 2-[(5-bromo-2-propoxyphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(5-bromo-2-propoxyphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 65312603 |
| Molecular Formula | C13H20BrNO3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[(5-bromo-2-propoxyphenyl)methylamino]propane-1,3-diol |
| SMILES | CCCOc1ccc(Br)cc1CNC(CO)CO |
| InChI | InChI=1S/C13H20BrNO3/c1-2-5-18-13-4-3-11(14)6-10(13)7-15-12(8-16)9-17/h3-4,6,12,15-17H,2,5,7-9H2,1H3 |
| InChIKey | KZVRSVYSPQJDIP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |