C18H21BrClNO2 — CID 40726356
(2S)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol (PubChem CID 40726356) has the molecular formula C18H21BrClNO2 and a molecular weight of 398.73 g/mol. Its IUPAC name is (2S)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol.
| Compound Name | (2S)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 40726356 |
| Molecular Formula | C18H21BrClNO2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (2S)-2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]butan-1-ol |
| SMILES | CC[C@@H](CO)NCc1cc(Br)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H21BrClNO2/c1-2-16(11-22)21-10-14-9-15(19)7-8-18(14)23-12-13-5-3-4-6-17(13)20/h3-9,16,21-22H,2,10-12H2,1H3/t16-/m0/s1 |
| InChIKey | LBZSWYDOLDHCDW-INIZCTEOSA-N |
| XLogP | 4.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |