C17H17BrClNO3 — CID 66527672
2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]propanoic acid (PubChem CID 66527672) has the molecular formula C17H17BrClNO3 and a molecular weight of 398.68 g/mol. Its IUPAC name is 2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]propanoic acid.
| Compound Name | 2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66527672 |
| Molecular Formula | C17H17BrClNO3 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 2-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylamino]propanoic acid |
| SMILES | CC(NCc1cc(Br)ccc1OCc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C17H17BrClNO3/c1-11(17(21)22)20-9-13-8-14(18)6-7-16(13)23-10-12-4-2-3-5-15(12)19/h2-8,11,20H,9-10H2,1H3,(H,21,22) |
| InChIKey | JFFPZOBNRAYZKD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |