C20H23BrFNO3 — CID 66527664
2-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid (PubChem CID 66527664) has the molecular formula C20H23BrFNO3 and a molecular weight of 424.31 g/mol. Its IUPAC name is 2-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66527664 |
| Molecular Formula | C20H23BrFNO3 |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCc1cc(Br)ccc1OCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C20H23BrFNO3/c1-13(2)9-18(20(24)25)23-11-15-10-16(21)7-8-19(15)26-12-14-5-3-4-6-17(14)22/h3-8,10,13,18,23H,9,11-12H2,1-2H3,(H,24,25) |
| InChIKey | SQAZFHBXYOSMIU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |