C21H26FNO4 — CID 66527077
2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-4-methylpentanoic acid (PubChem CID 66527077) has the molecular formula C21H26FNO4 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66527077 |
| Molecular Formula | C21H26FNO4 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-4-methylpentanoic acid |
| SMILES | COc1cccc(CNC(CC(C)C)C(=O)O)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H26FNO4/c1-14(2)11-18(21(24)25)23-12-15-8-6-10-19(26-3)20(15)27-13-16-7-4-5-9-17(16)22/h4-10,14,18,23H,11-13H2,1-3H3,(H,24,25) |
| InChIKey | INLRBZQVDUSRCJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |