C17H16BrClFNO3 — CID 66528187
2-[[5-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]propanoic acid (PubChem CID 66528187) has the molecular formula C17H16BrClFNO3 and a molecular weight of 416.67 g/mol. Its IUPAC name is 2-[[5-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]propanoic acid.
| Compound Name | 2-[[5-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66528187 |
| Molecular Formula | C17H16BrClFNO3 |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 2-[[5-bromo-2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]propanoic acid |
| SMILES | CC(NCc1cc(Br)ccc1OCc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C17H16BrClFNO3/c1-10(17(22)23)21-8-11-7-12(18)5-6-16(11)24-9-13-14(19)3-2-4-15(13)20/h2-7,10,21H,8-9H2,1H3,(H,22,23) |
| InChIKey | BUNGPMDNZNXDQL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |