C19H24BrClFNO — CID 17210488
N-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17210488) has the molecular formula C19H24BrClFNO and a molecular weight of 416.76 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17210488 |
| Molecular Formula | C19H24BrClFNO |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)CCNCc1cc(Br)ccc1OCc1ccccc1F.Cl |
| InChI | InChI=1S/C19H23BrFNO.ClH/c1-14(2)9-10-22-12-16-11-17(20)7-8-19(16)23-13-15-5-3-4-6-18(15)21;/h3-8,11,14,22H,9-10,12-13H2,1-2H3;1H |
| InChIKey | SDMXTNQRHYPAGQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|