C20H24BrCl2NO — CID 17296024
N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexanamine;hydrochloride (PubChem CID 17296024) has the molecular formula C20H24BrCl2NO and a molecular weight of 445.23 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexanamine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexanamine;hydrochloride |
|---|---|
| PubChem CID | 17296024 |
| Molecular Formula | C20H24BrCl2NO |
| Molecular Weight | 445.23 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexanamine;hydrochloride |
| SMILES | Cl.Clc1ccccc1COc1ccc(Br)cc1CNC1CCCCC1 |
| InChI | InChI=1S/C20H23BrClNO.ClH/c21-17-10-11-20(24-14-15-6-4-5-9-19(15)22)16(12-17)13-23-18-7-2-1-3-8-18;/h4-6,9-12,18,23H,1-3,7-8,13-14H2;1H |
| InChIKey | QQPAOVJYQXPRNC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.23 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |