C17H20BrCl2NO — CID 17155854
N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride (PubChem CID 17155854) has the molecular formula C17H20BrCl2NO and a molecular weight of 405.16 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17155854 |
| Molecular Formula | C17H20BrCl2NO |
| Molecular Weight | 405.16 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methyl]propan-2-amine;hydrochloride |
| SMILES | CC(C)NCc1cc(Br)ccc1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C17H19BrClNO.ClH/c1-12(2)20-10-14-9-15(18)7-8-17(14)21-11-13-5-3-4-6-16(13)19;/h3-9,12,20H,10-11H2,1-2H3;1H |
| InChIKey | JQIGQDVULVJQGZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.16 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |