C17H20BrNO — CID 43765740
N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylaniline (PubChem CID 43765740) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylaniline.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 43765740 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylaniline |
| SMILES | CCCOc1ccc(Br)cc1CNc1ccc(C)cc1 |
| InChI | InChI=1S/C17H20BrNO/c1-3-10-20-17-9-6-15(18)11-14(17)12-19-16-7-4-13(2)5-8-16/h4-9,11,19H,3,10,12H2,1-2H3 |
| InChIKey | ZOBULFVKMFZOAP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |