C16H16BrCl2NO — CID 65468190
N-[(5-bromo-2-propoxyphenyl)methyl]-2,6-dichloroaniline (PubChem CID 65468190) has the molecular formula C16H16BrCl2NO and a molecular weight of 389.12 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-2,6-dichloroaniline.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-2,6-dichloroaniline |
|---|---|
| PubChem CID | 65468190 |
| Molecular Formula | C16H16BrCl2NO |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-2,6-dichloroaniline |
| SMILES | CCCOc1ccc(Br)cc1CNc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H16BrCl2NO/c1-2-8-21-15-7-6-12(17)9-11(15)10-20-16-13(18)4-3-5-14(16)19/h3-7,9,20H,2,8,10H2,1H3 |
| InChIKey | YOJVBLUAZSVJOF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |