C17H19BrINO — CID 43785187
N-[(5-bromo-2-propoxyphenyl)methyl]-4-iodo-2-methylaniline (PubChem CID 43785187) has the molecular formula C17H19BrINO and a molecular weight of 460.15 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-4-iodo-2-methylaniline.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 43785187 |
| Molecular Formula | C17H19BrINO |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-iodo-2-methylaniline |
| SMILES | CCCOc1ccc(Br)cc1CNc1ccc(I)cc1C |
| InChI | InChI=1S/C17H19BrINO/c1-3-8-21-17-7-4-14(18)10-13(17)11-20-16-6-5-15(19)9-12(16)2/h4-7,9-10,20H,3,8,11H2,1-2H3 |
| InChIKey | OILIAKUKWJYZEQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|