C16H24BrNO2 — CID 62551822
[1-[(5-bromo-2-methoxyphenyl)methylamino]-3-methylcyclohexyl]methanol (PubChem CID 62551822) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is [1-[(5-bromo-2-methoxyphenyl)methylamino]-3-methylcyclohexyl]methanol.
| Compound Name | [1-[(5-bromo-2-methoxyphenyl)methylamino]-3-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 62551822 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [1-[(5-bromo-2-methoxyphenyl)methylamino]-3-methylcyclohexyl]methanol |
| SMILES | COc1ccc(Br)cc1CNC1(CO)CCCC(C)C1 |
| InChI | InChI=1S/C16H24BrNO2/c1-12-4-3-7-16(9-12,11-19)18-10-13-8-14(17)5-6-15(13)20-2/h5-6,8,12,18-19H,3-4,7,9-11H2,1-2H3 |
| InChIKey | YSGQHCCYBFEGCS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |