C12H17Br2NS — CID 107961490
N-[(2,5-dibromothiophen-3-yl)methyl]cycloheptanamine (PubChem CID 107961490) has the molecular formula C12H17Br2NS and a molecular weight of 367.15 g/mol. Its IUPAC name is N-[(2,5-dibromothiophen-3-yl)methyl]cycloheptanamine.
| Compound Name | N-[(2,5-dibromothiophen-3-yl)methyl]cycloheptanamine |
|---|---|
| PubChem CID | 107961490 |
| Molecular Formula | C12H17Br2NS |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | N-[(2,5-dibromothiophen-3-yl)methyl]cycloheptanamine |
| SMILES | Brc1cc(CNC2CCCCCC2)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2NS/c13-11-7-9(12(14)16-11)8-15-10-5-3-1-2-4-6-10/h7,10,15H,1-6,8H2 |
| InChIKey | OFVRKBIYJPTHRS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |