C11H19Cl2N3 — CID 115614135
N-[(2-chloro-3-pyridinyl)methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride (PubChem CID 115614135) has the molecular formula C11H19Cl2N3 and a molecular weight of 264.20 g/mol. Its IUPAC name is N-[(2-chloro-3-pyridinyl)methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride.
| Compound Name | N-[(2-chloro-3-pyridinyl)methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 115614135 |
| Molecular Formula | C11H19Cl2N3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[(2-chloro-3-pyridinyl)methyl]-N',N'-dimethylpropane-1,3-diamine;hydrochloride |
| SMILES | CN(C)CCCNCc1cccnc1Cl.Cl |
| InChI | InChI=1S/C11H18ClN3.ClH/c1-15(2)8-4-6-13-9-10-5-3-7-14-11(10)12;/h3,5,7,13H,4,6,8-9H2,1-2H3;1H |
| InChIKey | VNYVDZDNZINSBY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|