C24H26BClF8O4 — CID 161350887
1-chloro-3-fluoro-5-(2,2,2-trifluoroethoxymethyl)benzene;2-[3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 161350887) has the molecular formula C24H26BClF8O4 and a molecular weight of 576.72 g/mol. Its IUPAC name is 1-chloro-3-fluoro-5-(2,2,2-trifluoroethoxymethyl)benzene;2-[3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 1-chloro-3-fluoro-5-(2,2,2-trifluoroethoxymethyl)benzene;2-[3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 161350887 |
| Molecular Formula | C24H26BClF8O4 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 1-chloro-3-fluoro-5-(2,2,2-trifluoroethoxymethyl)benzene;2-[3-fluoro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(F)cc(COCC(F)(F)F)c2)OC1(C)C.Fc1cc(Cl)cc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H19BF4O3.C9H7ClF4O/c1-13(2)14(3,4)23-16(22-13)11-5-10(6-12(17)7-11)8-21-9-15(18,19)20;10-7-1-6(2-8(11)3-7)4-15-5-9(12,13)14/h5-7H,8-9H2,1-4H3;1-3H,4-5H2 |
| InChIKey | VNXHPIRMBKPUBW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|