C15H19BClF3O3 — CID 71287756
2-[3-chloro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 71287756) has the molecular formula C15H19BClF3O3 and a molecular weight of 350.57 g/mol. Its IUPAC name is 2-[3-chloro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-chloro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 71287756 |
| Molecular Formula | C15H19BClF3O3 |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 2-[3-chloro-5-(2,2,2-trifluoroethoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(Cl)cc(COCC(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C15H19BClF3O3/c1-13(2)14(3,4)23-16(22-13)11-5-10(6-12(17)7-11)8-21-9-15(18,19)20/h5-7H,8-9H2,1-4H3 |
| InChIKey | KSSOIIALQSKLTH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|