C28H43BO3Si — CID 11476848
[4-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-trimethylsilane (PubChem CID 11476848) has the molecular formula C28H43BO3Si and a molecular weight of 466.55 g/mol. Its IUPAC name is [4-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11476848 |
| Molecular Formula | C28H43BO3Si |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [4-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-trimethylsilane |
| SMILES | CCCCCCOCc1cc(B2OC(C)(C)C(C)(C)O2)cc(-c2ccc([Si](C)(C)C)cc2)c1 |
| InChI | InChI=1S/C28H43BO3Si/c1-9-10-11-12-17-30-21-22-18-24(23-13-15-26(16-14-23)33(6,7)8)20-25(19-22)29-31-27(2,3)28(4,5)32-29/h13-16,18-20H,9-12,17,21H2,1-8H3 |
| InChIKey | WMGDTWQSYRNRMX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|