C24H33BBrNO3 — CID 10624330
2-bromo-5-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 10624330) has the molecular formula C24H33BBrNO3 and a molecular weight of 474.25 g/mol. Its IUPAC name is 2-bromo-5-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-bromo-5-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 10624330 |
| Molecular Formula | C24H33BBrNO3 |
| Molecular Weight | 474.25 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-bromo-5-[3-(hexoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CCCCCCOCc1cc(B2OC(C)(C)C(C)(C)O2)cc(-c2ccc(Br)nc2)c1 |
| InChI | InChI=1S/C24H33BBrNO3/c1-6-7-8-9-12-28-17-18-13-20(19-10-11-22(26)27-16-19)15-21(14-18)25-29-23(2,3)24(4,5)30-25/h10-11,13-16H,6-9,12,17H2,1-5H3 |
| InChIKey | UFAATLDYIGZZKP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.25 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|