C21H30BrNOSn — CID 15879860
[5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-trimethylstannane (PubChem CID 15879860) has the molecular formula C21H30BrNOSn and a molecular weight of 511.09 g/mol. Its IUPAC name is [5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-trimethylstannane.
| Compound Name | [5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-trimethylstannane |
|---|---|
| PubChem CID | 15879860 |
| Molecular Formula | C21H30BrNOSn |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | [5-[3-bromo-5-(hexoxymethyl)phenyl]-2-pyridinyl]-trimethylstannane |
| SMILES | CCCCCCOCc1cc(Br)cc(-c2ccc([Sn](C)(C)C)nc2)c1 |
| InChI | InChI=1S/C18H21BrNO.3CH3.Sn/c1-2-3-4-5-9-21-14-15-10-17(12-18(19)11-15)16-7-6-8-20-13-16;;;;/h6-7,10-13H,2-5,9,14H2,1H3;3*1H3; |
| InChIKey | PLIPBVHQORBTKF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|