About 4-(hexoxymethyl)-2,6-diiodopyridine
4-(hexoxymethyl)-2,6-diiodopyridine (PubChem CID 11525108) has the molecular formula C12H17I2NO
and a molecular weight of 445.08 g/mol. Its IUPAC name is 4-(hexoxymethyl)-2,6-diiodopyridine.
Molecular Properties
| Compound Name | 4-(hexoxymethyl)-2,6-diiodopyridine |
| PubChem CID | 11525108 |
| Molecular Formula | C12H17I2NO |
| Molecular Weight | 445.08 g/mol |
| Exact Mass | 444.94 |
| IUPAC Name | 4-(hexoxymethyl)-2,6-diiodopyridine |
| SMILES | CCCCCCOCc1cc(I)nc(I)c1 |
| InChI | InChI=1S/C12H17I2NO/c1-2-3-4-5-6-16-9-10-7-11(13)15-12(14)8-10/h7-8H,2-6,9H2,1H3 |
| InChIKey | BLWRXZYSLRXAPU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.08 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(hexoxymethyl)-2,6-diiodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hexoxymethyl)-2,6-diiodopyridine?
The IUPAC name of 4-(hexoxymethyl)-2,6-diiodopyridine (CID 11525108) is 4-(hexoxymethyl)-2,6-diiodopyridine.
What is the SMILES notation for 4-(hexoxymethyl)-2,6-diiodopyridine?
The canonical SMILES for 4-(hexoxymethyl)-2,6-diiodopyridine is CCCCCCOCc1cc(I)nc(I)c1.
What is the InChIKey of 4-(hexoxymethyl)-2,6-diiodopyridine?
The InChIKey is BLWRXZYSLRXAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17I2NO/c1-2-3-4-5-6-16-9-10-7-11(13)15-12(14)8-10/h7-8H,2-6,9H2,1H3.
What are the key properties of 4-(hexoxymethyl)-2,6-diiodopyridine?
4-(hexoxymethyl)-2,6-diiodopyridine has a molecular weight of 445.08 g/mol, XLogP of 4.39, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hexoxymethyl)-2,6-diiodopyridine is sourced from PubChem (CID 11525108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).