C12H17Br2NO — CID 11002629
2,6-dibromo-4-(hexoxymethyl)pyridine (PubChem CID 11002629) has the molecular formula C12H17Br2NO and a molecular weight of 351.08 g/mol. Its IUPAC name is 2,6-dibromo-4-(hexoxymethyl)pyridine.
| Compound Name | 2,6-dibromo-4-(hexoxymethyl)pyridine |
|---|---|
| PubChem CID | 11002629 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 2,6-dibromo-4-(hexoxymethyl)pyridine |
| SMILES | CCCCCCOCc1cc(Br)nc(Br)c1 |
| InChI | InChI=1S/C12H17Br2NO/c1-2-3-4-5-6-16-9-10-7-11(13)15-12(14)8-10/h7-8H,2-6,9H2,1H3 |
| InChIKey | RGGRVDLDUOFTDR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|