C19H27BFN3O2 — CID 113250318
3,5-diethyl-1-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-triazole (PubChem CID 113250318) has the molecular formula C19H27BFN3O2 and a molecular weight of 359.25 g/mol. Its IUPAC name is 3,5-diethyl-1-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-triazole.
| Compound Name | 3,5-diethyl-1-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 113250318 |
| Molecular Formula | C19H27BFN3O2 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3,5-diethyl-1-[[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-1,2,4-triazole |
| SMILES | CCc1nc(CC)n(Cc2cc(F)cc(B3OC(C)(C)C(C)(C)O3)c2)n1 |
| InChI | InChI=1S/C19H27BFN3O2/c1-7-16-22-17(8-2)24(23-16)12-13-9-14(11-15(21)10-13)20-25-18(3,4)19(5,6)26-20/h9-11H,7-8,12H2,1-6H3 |
| InChIKey | FWLQAYAEJNMQBW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|