C23H27BClN5O2 — CID 70979761
6-(5-chloro-2-pyridinyl)-1,4-dimethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine (PubChem CID 70979761) has the molecular formula C23H27BClN5O2 and a molecular weight of 451.77 g/mol. Its IUPAC name is 6-(5-chloro-2-pyridinyl)-1,4-dimethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine.
| Compound Name | 6-(5-chloro-2-pyridinyl)-1,4-dimethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
|---|---|
| PubChem CID | 70979761 |
| Molecular Formula | C23H27BClN5O2 |
| Molecular Weight | 451.77 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 6-(5-chloro-2-pyridinyl)-1,4-dimethyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
| SMILES | Cc1nnc2n1-c1ccc(B3OC(C)(C)C(C)(C)O3)cc1N(c1ccc(Cl)cn1)CC2C |
| InChI | InChI=1S/C23H27BClN5O2/c1-14-13-29(20-10-8-17(25)12-26-20)19-11-16(24-31-22(3,4)23(5,6)32-24)7-9-18(19)30-15(2)27-28-21(14)30/h7-12,14H,13H2,1-6H3 |
| InChIKey | LAKQPQCIHJJREQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|