C21H19ClN8 — CID 70978622
5-[(4R)-6-(5-chloro-2-pyridinyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]pyrazin-2-amine (PubChem CID 70978622) has the molecular formula C21H19ClN8 and a molecular weight of 418.89 g/mol. Its IUPAC name is 5-[(4R)-6-(5-chloro-2-pyridinyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]pyrazin-2-amine.
| Compound Name | 5-[(4R)-6-(5-chloro-2-pyridinyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 70978622 |
| Molecular Formula | C21H19ClN8 |
| Molecular Weight | 418.89 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 5-[(4R)-6-(5-chloro-2-pyridinyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]pyrazin-2-amine |
| SMILES | Cc1nnc2n1-c1ccc(-c3cnc(N)cn3)cc1N(c1ccc(Cl)cn1)C[C@H]2C |
| InChI | InChI=1S/C21H19ClN8/c1-12-11-29(20-6-4-15(22)8-26-20)18-7-14(16-9-25-19(23)10-24-16)3-5-17(18)30-13(2)27-28-21(12)30/h3-10,12H,11H2,1-2H3,(H2,23,25)/t12-/m1/s1 |
| InChIKey | LVNBVTUQQHMAJX-GFCCVEGCSA-N |
| XLogP | 3.92 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|