C23H23ClN6 — CID 70979282
(4R)-6-(4-chlorophenyl)-8-(1,5-dimethylpyrazol-4-yl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine (PubChem CID 70979282) has the molecular formula C23H23ClN6 and a molecular weight of 418.93 g/mol. Its IUPAC name is (4R)-6-(4-chlorophenyl)-8-(1,5-dimethylpyrazol-4-yl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine.
| Compound Name | (4R)-6-(4-chlorophenyl)-8-(1,5-dimethylpyrazol-4-yl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
|---|---|
| PubChem CID | 70979282 |
| Molecular Formula | C23H23ClN6 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (4R)-6-(4-chlorophenyl)-8-(1,5-dimethylpyrazol-4-yl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
| SMILES | Cc1c(-c2ccc3c(c2)N(c2ccc(Cl)cc2)C[C@@H](C)c2nnc(C)n2-3)cnn1C |
| InChI | InChI=1S/C23H23ClN6/c1-14-13-29(19-8-6-18(24)7-9-19)22-11-17(20-12-25-28(4)15(20)2)5-10-21(22)30-16(3)26-27-23(14)30/h5-12,14H,13H2,1-4H3/t14-/m1/s1 |
| InChIKey | SHIULCRPVXRVNO-CQSZACIVSA-N |
| XLogP | 5.19 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|