C23H19ClIN5O — CID 89180930
5-[(4R)-6-(4-chlorophenyl)-4-iodo-1-methyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-1-methylpyridin-2-one (PubChem CID 89180930) has the molecular formula C23H19ClIN5O and a molecular weight of 543.80 g/mol. Its IUPAC name is 5-[(4R)-6-(4-chlorophenyl)-4-iodo-1-methyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[(4R)-6-(4-chlorophenyl)-4-iodo-1-methyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 89180930 |
| Molecular Formula | C23H19ClIN5O |
| Molecular Weight | 543.80 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | 5-[(4R)-6-(4-chlorophenyl)-4-iodo-1-methyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-1-methylpyridin-2-one |
| SMILES | Cc1nnc2n1-c1ccc(-c3ccc(=O)n(C)c3)cc1N(c1ccc(Cl)cc1)C[C@H]2I |
| InChI | InChI=1S/C23H19ClIN5O/c1-14-26-27-23-19(25)13-29(18-7-5-17(24)6-8-18)21-11-15(3-9-20(21)30(14)23)16-4-10-22(31)28(2)12-16/h3-12,19H,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | BXZWCNPYUGQWOG-LJQANCHMSA-N |
| XLogP | 5.22 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|