C22H23N7OS — CID 130253905
1,4-dimethyl-6-(4-methylsulfinylphenyl)-8-(2-methyltriazol-4-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine (PubChem CID 130253905) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 1,4-dimethyl-6-(4-methylsulfinylphenyl)-8-(2-methyltriazol-4-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine.
| Compound Name | 1,4-dimethyl-6-(4-methylsulfinylphenyl)-8-(2-methyltriazol-4-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
|---|---|
| PubChem CID | 130253905 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1,4-dimethyl-6-(4-methylsulfinylphenyl)-8-(2-methyltriazol-4-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
| SMILES | Cc1nnc2n1-c1ccc(-c3cnn(C)n3)cc1N(c1ccc(S(C)=O)cc1)CC2C |
| InChI | InChI=1S/C22H23N7OS/c1-14-13-28(17-6-8-18(9-7-17)31(4)30)21-11-16(19-12-23-27(3)26-19)5-10-20(21)29-15(2)24-25-22(14)29/h5-12,14H,13H2,1-4H3 |
| InChIKey | URVVXAOCUZXZMH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|