C23H24ClN5O2 — CID 70979178
[6-(4-chlorophenyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-morpholin-4-ylmethanone (PubChem CID 70979178) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(4-chlorophenyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 70979178 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [6-(4-chlorophenyl)-1,4-dimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-8-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nnc2n1-c1ccc(C(=O)N3CCOCC3)cc1N(c1ccc(Cl)cc1)CC2C |
| InChI | InChI=1S/C23H24ClN5O2/c1-15-14-28(19-6-4-18(24)5-7-19)21-13-17(23(30)27-9-11-31-12-10-27)3-8-20(21)29-16(2)25-26-22(15)29/h3-8,13,15H,9-12,14H2,1-2H3 |
| InChIKey | XSFSPCZXJDJIBA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |