C22H26ClN5O — CID 130253991
[6-(4-chlorophenyl)-1-methyl-1,2,3,3a,4,5-hexahydro-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-8-yl]-pyrrolidin-1-ylmethanone (PubChem CID 130253991) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-1-methyl-1,2,3,3a,4,5-hexahydro-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-8-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-(4-chlorophenyl)-1-methyl-1,2,3,3a,4,5-hexahydro-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-8-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 130253991 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [6-(4-chlorophenyl)-1-methyl-1,2,3,3a,4,5-hexahydro-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-8-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC1NNC2CCN(c3ccc(Cl)cc3)c3cc(C(=O)N4CCCC4)ccc3N12 |
| InChI | InChI=1S/C22H26ClN5O/c1-15-24-25-21-10-13-27(18-7-5-17(23)6-8-18)20-14-16(4-9-19(20)28(15)21)22(29)26-11-2-3-12-26/h4-9,14-15,21,24-25H,2-3,10-13H2,1H3 |
| InChIKey | ZZWYEKXRAJJLOJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |