C19H19ClN4 — CID 130253977
(4R)-6-(4-chlorophenyl)-1,4,8-trimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine (PubChem CID 130253977) has the molecular formula C19H19ClN4 and a molecular weight of 338.84 g/mol. Its IUPAC name is (4R)-6-(4-chlorophenyl)-1,4,8-trimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine.
| Compound Name | (4R)-6-(4-chlorophenyl)-1,4,8-trimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
|---|---|
| PubChem CID | 130253977 |
| Molecular Formula | C19H19ClN4 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (4R)-6-(4-chlorophenyl)-1,4,8-trimethyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
| SMILES | Cc1ccc2c(c1)N(c1ccc(Cl)cc1)C[C@@H](C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C19H19ClN4/c1-12-4-9-17-18(10-12)23(16-7-5-15(20)6-8-16)11-13(2)19-22-21-14(3)24(17)19/h4-10,13H,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | BSAMTOMVFGPBKF-CYBMUJFWSA-N |
| XLogP | 4.79 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |