C22H19N9 — CID 78076868
4-[12-(5-aminopyrazin-2-yl)-3,7-dimethyl-2,4,5,9,13-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),3,5,10,12-pentaen-9-yl]benzonitrile (PubChem CID 78076868) has the molecular formula C22H19N9 and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-[12-(5-aminopyrazin-2-yl)-3,7-dimethyl-2,4,5,9,13-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),3,5,10,12-pentaen-9-yl]benzonitrile.
| Compound Name | 4-[12-(5-aminopyrazin-2-yl)-3,7-dimethyl-2,4,5,9,13-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),3,5,10,12-pentaen-9-yl]benzonitrile |
|---|---|
| PubChem CID | 78076868 |
| Molecular Formula | C22H19N9 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-[12-(5-aminopyrazin-2-yl)-3,7-dimethyl-2,4,5,9,13-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),3,5,10,12-pentaen-9-yl]benzonitrile |
| SMILES | Cc1nnc2n1-c1cnc(-c3cnc(N)cn3)cc1N(c1ccc(C#N)cc1)CC2C |
| InChI | InChI=1S/C22H19N9/c1-13-12-30(16-5-3-15(8-23)4-6-16)19-7-17(18-9-27-21(24)11-26-18)25-10-20(19)31-14(2)28-29-22(13)31/h3-7,9-11,13H,12H2,1-2H3,(H2,24,27) |
| InChIKey | XPEFHSMVSXAINA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|