C24H26BN5O2 — CID 123849972
4-[1,4-dimethyl-8-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-6-yl]benzonitrile (PubChem CID 123849972) has the molecular formula C24H26BN5O2 and a molecular weight of 427.32 g/mol. Its IUPAC name is 4-[1,4-dimethyl-8-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-6-yl]benzonitrile.
| Compound Name | 4-[1,4-dimethyl-8-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 123849972 |
| Molecular Formula | C24H26BN5O2 |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-[1,4-dimethyl-8-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepin-6-yl]benzonitrile |
| SMILES | Cc1nnc2n1-c1ccc(B3OC(C)C(C)(C)O3)cc1N(c1ccc(C#N)cc1)CC2C |
| InChI | InChI=1S/C24H26BN5O2/c1-15-14-29(20-9-6-18(13-26)7-10-20)22-12-19(25-31-16(2)24(4,5)32-25)8-11-21(22)30-17(3)27-28-23(15)30/h6-12,15-16H,14H2,1-5H3 |
| InChIKey | IHBGSLFHYPBSCZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|