C18H27BClNO3 — CID 174187204
1-[8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-ol (PubChem CID 174187204) has the molecular formula C18H27BClNO3 and a molecular weight of 351.68 g/mol. Its IUPAC name is 1-[8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-ol.
| Compound Name | 1-[8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 174187204 |
| Molecular Formula | C18H27BClNO3 |
| Molecular Weight | 351.68 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[8-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]propan-2-ol |
| SMILES | CC(O)CN1CCc2cc(B3OC(C)(C)C(C)(C)O3)cc(Cl)c2C1 |
| InChI | InChI=1S/C18H27BClNO3/c1-12(22)10-21-7-6-13-8-14(9-16(20)15(13)11-21)19-23-17(2,3)18(4,5)24-19/h8-9,12,22H,6-7,10-11H2,1-5H3 |
| InChIKey | QKSSHDBAUKAWEX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|