C16H21BClNO5 — CID 90190165
[7-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-yl]methylcarbamic acid (PubChem CID 90190165) has the molecular formula C16H21BClNO5 and a molecular weight of 353.61 g/mol. Its IUPAC name is [7-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-yl]methylcarbamic acid.
| Compound Name | [7-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 90190165 |
| Molecular Formula | C16H21BClNO5 |
| Molecular Weight | 353.61 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [7-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1-benzofuran-2-yl]methylcarbamic acid |
| SMILES | CC1(C)OB(c2cc(Cl)c3c(c2)CC(CNC(=O)O)O3)OC1(C)C |
| InChI | InChI=1S/C16H21BClNO5/c1-15(2)16(3,4)24-17(23-15)10-5-9-6-11(8-19-14(20)21)22-13(9)12(18)7-10/h5,7,11,19H,6,8H2,1-4H3,(H,20,21) |
| InChIKey | GYQNIKVOOPNIJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|