C20H23BN2O2 — CID 11493710
7-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazo[1,2-a]pyridine (PubChem CID 11493710) has the molecular formula C20H23BN2O2 and a molecular weight of 334.23 g/mol. Its IUPAC name is 7-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 7-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 11493710 |
| Molecular Formula | C20H23BN2O2 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 7-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2c(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)cnc2c1 |
| InChI | InChI=1S/C20H23BN2O2/c1-14-9-10-23-17(13-22-18(23)11-14)15-7-6-8-16(12-15)21-24-19(2,3)20(4,5)25-21/h6-13H,1-5H3 |
| InChIKey | GDUGDUKYGLQYHL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|