C22H24BF3N4O3 — CID 59320805
1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 59320805) has the molecular formula C22H24BF3N4O3 and a molecular weight of 460.27 g/mol. Its IUPAC name is 1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 59320805 |
| Molecular Formula | C22H24BF3N4O3 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC1(C)OB(c2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)OC1(C)C |
| InChI | InChI=1S/C22H24BF3N4O3/c1-20(2)21(3,4)33-23(32-20)15-8-9-30-17(12-27-18(30)11-15)14-6-5-7-16(10-14)29-19(31)28-13-22(24,25)26/h5-12H,13H2,1-4H3,(H2,28,29,31) |
| InChIKey | PTGHXWLASOUVCP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|