C20H19F3N4O3 — CID 68596128
1-[3-(7-cyclopropylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;formic acid (PubChem CID 68596128) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 1-[3-(7-cyclopropylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;formic acid.
| Compound Name | 1-[3-(7-cyclopropylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;formic acid |
|---|---|
| PubChem CID | 68596128 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[3-(7-cyclopropylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;formic acid |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(C4CC4)ccn23)c1.O=CO |
| InChI | InChI=1S/C19H17F3N4O.CH2O2/c20-19(21,22)11-24-18(27)25-15-3-1-2-14(8-15)16-10-23-17-9-13(12-4-5-12)6-7-26(16)17;2-1-3/h1-3,6-10,12H,4-5,11H2,(H2,24,25,27);1H,(H,2,3) |
| InChIKey | UZTREOCAGDBLTL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|