C20H19F3N4O3 — CID 87510363
2-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]propan-2-yl formate (PubChem CID 87510363) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 2-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]propan-2-yl formate.
| Compound Name | 2-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]propan-2-yl formate |
|---|---|
| PubChem CID | 87510363 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]propan-2-yl formate |
| SMILES | CC(C)(OC=O)c1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1 |
| InChI | InChI=1S/C20H19F3N4O3/c1-19(2,30-12-28)14-6-7-27-16(10-24-17(27)9-14)13-4-3-5-15(8-13)26-18(29)25-11-20(21,22)23/h3-10,12H,11H2,1-2H3,(H2,25,26,29) |
| InChIKey | FCJUAUXZNXSXOX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|