C16H14BF3N4O3 — CID 59320848
[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]boronic acid (PubChem CID 59320848) has the molecular formula C16H14BF3N4O3 and a molecular weight of 378.12 g/mol. Its IUPAC name is [3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]boronic acid.
| Compound Name | [3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]boronic acid |
|---|---|
| PubChem CID | 59320848 |
| Molecular Formula | C16H14BF3N4O3 |
| Molecular Weight | 378.12 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]boronic acid |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(B(O)O)ccn23)c1 |
| InChI | InChI=1S/C16H14BF3N4O3/c18-16(19,20)9-22-15(25)23-12-3-1-2-10(6-12)13-8-21-14-7-11(17(26)27)4-5-24(13)14/h1-8,26-27H,9H2,(H2,22,23,25) |
| InChIKey | SISZSXSBESZRIZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|