C26H24F3N5O4 — CID 68595103
N-ethyl-3-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]benzamide;formic acid (PubChem CID 68595103) has the molecular formula C26H24F3N5O4 and a molecular weight of 527.50 g/mol. Its IUPAC name is N-ethyl-3-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]benzamide;formic acid.
| Compound Name | N-ethyl-3-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]benzamide;formic acid |
|---|---|
| PubChem CID | 68595103 |
| Molecular Formula | C26H24F3N5O4 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | N-ethyl-3-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]benzamide;formic acid |
| SMILES | CCNC(=O)c1cccc(-c2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)c1.O=CO |
| InChI | InChI=1S/C25H22F3N5O2.CH2O2/c1-2-29-23(34)19-7-3-5-16(11-19)17-9-10-33-21(14-30-22(33)13-17)18-6-4-8-20(12-18)32-24(35)31-15-25(26,27)28;2-1-3/h3-14H,2,15H2,1H3,(H,29,34)(H2,31,32,35);1H,(H,2,3) |
| InChIKey | XFJMSBZCKXZLOO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|