C20H17N3 — CID 143707303
3-[7-(3-methylphenyl)imidazo[1,2-a]pyridin-3-yl]aniline (PubChem CID 143707303) has the molecular formula C20H17N3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 3-[7-(3-methylphenyl)imidazo[1,2-a]pyridin-3-yl]aniline.
| Compound Name | 3-[7-(3-methylphenyl)imidazo[1,2-a]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 143707303 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[7-(3-methylphenyl)imidazo[1,2-a]pyridin-3-yl]aniline |
| SMILES | Cc1cccc(-c2ccn3c(-c4cccc(N)c4)cnc3c2)c1 |
| InChI | InChI=1S/C20H17N3/c1-14-4-2-5-15(10-14)16-8-9-23-19(13-22-20(23)12-16)17-6-3-7-18(21)11-17/h2-13H,21H2,1H3 |
| InChIKey | YYVVDDZNYISPKA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|