C29H25N5O — CID 162147656
3-imidazo[1,2-a]pyridin-3-ylaniline;1-(3-imidazo[1,2-a]pyridin-3-ylphenyl)propan-2-one (PubChem CID 162147656) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-ylaniline;1-(3-imidazo[1,2-a]pyridin-3-ylphenyl)propan-2-one.
| Compound Name | 3-imidazo[1,2-a]pyridin-3-ylaniline;1-(3-imidazo[1,2-a]pyridin-3-ylphenyl)propan-2-one |
|---|---|
| PubChem CID | 162147656 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-ylaniline;1-(3-imidazo[1,2-a]pyridin-3-ylphenyl)propan-2-one |
| SMILES | CC(=O)Cc1cccc(-c2cnc3ccccn23)c1.Nc1cccc(-c2cnc3ccccn23)c1 |
| InChI | InChI=1S/C16H14N2O.C13H11N3/c1-12(19)9-13-5-4-6-14(10-13)15-11-17-16-7-2-3-8-18(15)16;14-11-5-3-4-10(8-11)12-9-15-13-6-1-2-7-16(12)13/h2-8,10-11H,9H2,1H3;1-9H,14H2 |
| InChIKey | ZKTXMDPRFQBNJR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|