C12H9ClN4 — CID 58857683
3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)aniline (PubChem CID 58857683) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is 3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)aniline.
| Compound Name | 3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)aniline |
|---|---|
| PubChem CID | 58857683 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)aniline |
| SMILES | Nc1cccc(-c2cnc3ccc(Cl)nn23)c1 |
| InChI | InChI=1S/C12H9ClN4/c13-11-4-5-12-15-7-10(17(12)16-11)8-2-1-3-9(14)6-8/h1-7H,14H2 |
| InChIKey | QPIYTIVQAQQCFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|