C20H17N5O2 — CID 126470424
3-(3-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 126470424) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-(3-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 126470424 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-(3-aminophenyl)-N-(1,3-benzodioxol-5-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | Nc1cccc(-c2cnc3ccc(NCc4ccc5c(c4)OCO5)nn23)c1 |
| InChI | InChI=1S/C20H17N5O2/c21-15-3-1-2-14(9-15)16-11-23-20-7-6-19(24-25(16)20)22-10-13-4-5-17-18(8-13)27-12-26-17/h1-9,11H,10,12,21H2,(H,22,24) |
| InChIKey | CVMXZVQNUUZDHS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|